C36H30N4 — CID 163359228
5,15-bis(2,6-dimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 163359228) has the molecular formula C36H30N4 and a molecular weight of 518.66 g/mol. Its IUPAC name is 5,15-bis(2,6-dimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 5,15-bis(2,6-dimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 163359228 |
| Molecular Formula | C36H30N4 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 5,15-bis(2,6-dimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | Cc1cccc(C)c1-c1c2nc(cc3ccc([nH]3)c(-c3c(C)cccc3C)c3ccc(cc4nc1C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C36H30N4/c1-21-7-5-8-22(2)33(21)35-29-15-11-25(37-29)19-27-13-17-31(39-27)36(34-23(3)9-6-10-24(34)4)32-18-14-28(40-32)20-26-12-16-30(35)38-26/h5-20,37-38H,1-4H3/b25-19-,26-20-,27-19-,28-20-,35-29+,35-30+,36-31+,36-32+ |
| InChIKey | ILWALRTXBFBZFY-BNLPILBGSA-N |
| XLogP | 9.22 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |