C52H32N8 — CID 137270214
5-[8-(21,23-dihydroporphyrin-5-yl)biphenylen-1-yl]-21,23-dihydroporphyrin (PubChem CID 137270214) has the molecular formula C52H32N8 and a molecular weight of 768.88 g/mol. Its IUPAC name is 5-[8-(21,23-dihydroporphyrin-5-yl)biphenylen-1-yl]-21,23-dihydroporphyrin.
| Compound Name | 5-[8-(21,23-dihydroporphyrin-5-yl)biphenylen-1-yl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 137270214 |
| Molecular Formula | C52H32N8 |
| Molecular Weight | 768.88 g/mol |
| Exact Mass | 768.27 |
| IUPAC Name | 5-[8-(21,23-dihydroporphyrin-5-yl)biphenylen-1-yl]-21,23-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc([nH]3)c(-c3cccc4c3=c3c(-c5c6nc(cc7ccc(cc8nc(cc9ccc5[nH]9)C=C8)[nH]7)C=C6)cccc3=4)c3nc(cc4ccc(cc1n2)[nH]4)C=C3 |
| InChI | InChI=1S/C52H32N8/c1-3-41-42-4-2-6-44(52-47-21-17-39(59-47)27-35-13-9-31(55-35)24-32-10-14-36(56-32)28-40-18-22-48(52)60-40)50(42)49(41)43(5-1)51-45-19-15-37(57-45)25-33-11-7-29(53-33)23-30-8-12-34(54-30)26-38-16-20-46(51)58-38/h1-28,53,55,58,60H/b29-23-,30-23-,31-24-,32-24-,33-25-,34-26-,35-27-,36-28-,37-25-,38-26-,39-27-,40-28-,51-45-,51-46-,52-47-,52-48- |
| InChIKey | AMZSIBIOUFHOQG-BNYFRNPHSA-N |
| XLogP | 11.85 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.88 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |