C38H24CoN4 — CID 159060149
5-benzo[a]anthracen-1-yl-21,23-dihydroporphyrin;cobalt (PubChem CID 159060149) has the molecular formula C38H24CoN4 and a molecular weight of 595.57 g/mol. Its IUPAC name is 5-benzo[a]anthracen-1-yl-21,23-dihydroporphyrin;cobalt.
| Compound Name | 5-benzo[a]anthracen-1-yl-21,23-dihydroporphyrin;cobalt |
|---|---|
| PubChem CID | 159060149 |
| Molecular Formula | C38H24CoN4 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | 5-benzo[a]anthracen-1-yl-21,23-dihydroporphyrin;cobalt |
| SMILES | C1=Cc2cc3ccc([nH]3)c(-c3cccc4ccc5cc6ccccc6cc5c34)c3nc(cc4ccc(cc1n2)[nH]4)C=C3.[Co] |
| InChI | InChI=1S/C38H24N4.Co/c1-2-5-25-19-34-26(18-24(25)4-1)9-8-23-6-3-7-33(37(23)34)38-35-16-14-31(41-35)21-29-12-10-27(39-29)20-28-11-13-30(40-28)22-32-15-17-36(38)42-32;/h1-22,39,42H;/b27-20-,28-20-,29-21-,30-22-,31-21-,32-22-,38-35-,38-36-; |
| InChIKey | JYJATIJNVFATSB-UKBQKMGNSA-N |
| XLogP | 9.78 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|