C34H20Br2N4 — CID 176507460
5-(2,7-dibromoanthracen-9-yl)-21,23-dihydroporphyrin (PubChem CID 176507460) has the molecular formula C34H20Br2N4 and a molecular weight of 644.37 g/mol. Its IUPAC name is 5-(2,7-dibromoanthracen-9-yl)-21,23-dihydroporphyrin.
| Compound Name | 5-(2,7-dibromoanthracen-9-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 176507460 |
| Molecular Formula | C34H20Br2N4 |
| Molecular Weight | 644.37 g/mol |
| Exact Mass | 642.01 |
| IUPAC Name | 5-(2,7-dibromoanthracen-9-yl)-21,23-dihydroporphyrin |
| SMILES | Brc1ccc2cc3ccc(Br)cc3c(-c3c4nc(cc5ccc(cc6nc(cc7ccc3[nH]7)C=C6)[nH]5)C=C4)c2c1 |
| InChI | InChI=1S/C34H20Br2N4/c35-21-3-1-19-13-20-2-4-22(36)15-30(20)33(29(19)14-21)34-31-11-9-27(39-31)17-25-7-5-23(37-25)16-24-6-8-26(38-24)18-28-10-12-32(34)40-28/h1-18,37,40H/b23-16-,24-16-,25-17-,26-18-,27-17-,28-18-,34-31+,34-32+ |
| InChIKey | KVQNNFZARLHUEN-UEXSQAQGSA-N |
| XLogP | 10.15 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.37 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|