C50H32N4O2 — CID 136732257
2-[4-[4-[4-[4-(21,23-dihydroporphyrin-5-yl)phenyl]phenyl]phenyl]phenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 136732257) has the molecular formula C50H32N4O2 and a molecular weight of 720.83 g/mol. Its IUPAC name is 2-[4-[4-[4-[4-(21,23-dihydroporphyrin-5-yl)phenyl]phenyl]phenyl]phenyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[4-[4-[4-[4-(21,23-dihydroporphyrin-5-yl)phenyl]phenyl]phenyl]phenyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 136732257 |
| Molecular Formula | C50H32N4O2 |
| Molecular Weight | 720.83 g/mol |
| Exact Mass | 720.25 |
| IUPAC Name | 2-[4-[4-[4-[4-(21,23-dihydroporphyrin-5-yl)phenyl]phenyl]phenyl]phenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=CC(=O)C(c2ccc(-c3ccc(-c4ccc(-c5ccc(-c6c7nc(cc8ccc(cc9nc(cc%10ccc6[nH]%10)C=C9)[nH]8)C=C7)cc5)cc4)cc3)cc2)=C1 |
| InChI | InChI=1S/C50H32N4O2/c55-45-23-26-49(56)46(30-45)37-13-9-35(10-14-37)33-5-1-31(2-6-33)32-3-7-34(8-4-32)36-11-15-38(16-12-36)50-47-24-21-43(53-47)28-41-19-17-39(51-41)27-40-18-20-42(52-40)29-44-22-25-48(50)54-44/h1-30,51,54H/b39-27-,40-27-,41-28-,42-29-,43-28-,44-29-,50-47-,50-48- |
| InChIKey | LMODHJBKUYRYMY-FIEYAIRDSA-N |
| XLogP | 11.41 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.83 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|