C46H36N6O2 — CID 10908866
4-[15-[4-(4-methoxyanilino)phenyl]-21,22-dihydroporphyrin-5-yl]-N-(4-methoxyphenyl)aniline (PubChem CID 10908866) has the molecular formula C46H36N6O2 and a molecular weight of 704.83 g/mol. Its IUPAC name is 4-[15-[4-(4-methoxyanilino)phenyl]-21,22-dihydroporphyrin-5-yl]-N-(4-methoxyphenyl)aniline.
| Compound Name | 4-[15-[4-(4-methoxyanilino)phenyl]-21,22-dihydroporphyrin-5-yl]-N-(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 10908866 |
| Molecular Formula | C46H36N6O2 |
| Molecular Weight | 704.83 g/mol |
| Exact Mass | 704.29 |
| IUPAC Name | 4-[15-[4-(4-methoxyanilino)phenyl]-21,22-dihydroporphyrin-5-yl]-N-(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(Nc2ccc(-c3c4nc(cc5ccc([nH]5)c(-c5ccc(Nc6ccc(OC)cc6)cc5)c5ccc(cc6nc3C=C6)[nH]5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C46H36N6O2/c1-53-39-19-11-33(12-20-39)47-31-7-3-29(4-8-31)45-41-23-15-35(49-41)27-37-17-25-43(51-37)46(44-26-18-38(52-44)28-36-16-24-42(45)50-36)30-5-9-32(10-6-30)48-34-13-21-40(54-2)22-14-34/h3-28,47-50H,1-2H3/b35-27-,36-28-,37-27-,38-28-,45-41-,45-42-,46-43-,46-44- |
| InChIKey | YLPNMLWGFIVCTM-YPZFJWMUSA-N |
| XLogP | 11.49 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.83 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |