C42H46N6O2+2 — CID 135466414
trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethyl]azanium (PubChem CID 135466414) has the molecular formula C42H46N6O2+2 and a molecular weight of 666.87 g/mol. Its IUPAC name is trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 135466414 |
| Molecular Formula | C42H46N6O2+2 |
| Molecular Weight | 666.87 g/mol |
| Exact Mass | 666.37 |
| IUPAC Name | trimethyl-[2-[4-[15-[4-[2-(trimethylazaniumyl)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(OCC[N+](C)(C)C)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C42H46N6O2/c1-47(2,3)23-25-49-35-15-7-29(8-16-35)41-37-19-11-31(43-37)27-33-13-21-39(45-33)42(30-9-17-36(18-10-30)50-26-24-48(4,5)6)40-22-14-34(46-40)28-32-12-20-38(41)44-32/h7-22,27-28,43,46H,23-26H2,1-6H3/q+2/b31-27-,32-28-,33-27-,34-28-,41-37-,41-38-,42-39-,42-40- |
| InChIKey | CHDFSIFJHJRNSN-XWISPGCNSA-N |
| XLogP | 8.16 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.87 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|