C43H46N6O2 — CID 136654928
3-[4-[15-[4-[2-(diethylamino)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-N-ethylpropan-1-amine (PubChem CID 136654928) has the molecular formula C43H46N6O2 and a molecular weight of 678.88 g/mol. Its IUPAC name is 3-[4-[15-[4-[2-(diethylamino)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-N-ethylpropan-1-amine.
| Compound Name | 3-[4-[15-[4-[2-(diethylamino)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 136654928 |
| Molecular Formula | C43H46N6O2 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.37 |
| IUPAC Name | 3-[4-[15-[4-[2-(diethylamino)ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]phenoxy]-N-ethylpropan-1-amine |
| SMILES | CCNCCCOc1ccc(-c2c3nc(cc4ccc([nH]4)c(-c4ccc(OCCN(CC)CC)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C43H46N6O2/c1-4-44-24-7-26-50-36-16-8-30(9-17-36)42-38-20-12-32(45-38)28-34-14-22-40(47-34)43(41-23-15-35(48-41)29-33-13-21-39(42)46-33)31-10-18-37(19-11-31)51-27-25-49(5-2)6-3/h8-23,28-29,44-45,48H,4-7,24-27H2,1-3H3/b32-28-,33-29-,34-28-,35-29-,42-38-,42-39-,43-40-,43-41- |
| InChIKey | XDQLHWWPUXWLSE-CHZNTIKYSA-N |
| XLogP | 9.09 |
| TPSA | 91.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|