C52H62N4O4 — CID 136760152
5,15-bis(3,5-dipentoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 136760152) has the molecular formula C52H62N4O4 and a molecular weight of 807.09 g/mol. Its IUPAC name is 5,15-bis(3,5-dipentoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-dipentoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136760152 |
| Molecular Formula | C52H62N4O4 |
| Molecular Weight | 807.09 g/mol |
| Exact Mass | 806.48 |
| IUPAC Name | 5,15-bis(3,5-dipentoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | CCCCCOc1cc(OCCCCC)cc(-c2c3nc(cc4ccc([nH]4)c(-c4cc(OCCCCC)cc(OCCCCC)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C52H62N4O4/c1-5-9-13-25-57-43-29-37(30-44(35-43)58-26-14-10-6-2)51-47-21-17-39(53-47)33-41-19-23-49(55-41)52(50-24-20-42(56-50)34-40-18-22-48(51)54-40)38-31-45(59-27-15-11-7-3)36-46(32-38)60-28-16-12-8-4/h17-24,29-36,53,56H,5-16,25-28H2,1-4H3/b39-33-,40-34-,41-33-,42-34-,51-47-,51-48-,52-49-,52-50- |
| InChIKey | ZJVPWASRGYTYRA-LGMAEMKUSA-N |
| XLogP | 14.27 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.09 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|