C70H97BN4O6 — CID 135399947
5,15-bis(3,5-dioctoxyphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin (PubChem CID 135399947) has the molecular formula C70H97BN4O6 and a molecular weight of 1101.38 g/mol. Its IUPAC name is 5,15-bis(3,5-dioctoxyphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-dioctoxyphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135399947 |
| Molecular Formula | C70H97BN4O6 |
| Molecular Weight | 1101.38 g/mol |
| Exact Mass | 1100.75 |
| IUPAC Name | 5,15-bis(3,5-dioctoxyphenyl)-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-21,23-dihydroporphyrin |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)cc(-c2c3nc(c(B4OC(C)(C)C(C)(C)O4)c4ccc([nH]4)c(-c4cc(OCCCCCCCC)cc(OCCCCCCCC)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C70H97BN4O6/c1-9-13-17-21-25-29-41-76-56-45-52(46-57(50-56)77-42-30-26-22-18-14-10-2)66-60-35-33-54(72-60)49-55-34-36-61(73-55)67(63-38-40-65(75-63)68(64-39-37-62(66)74-64)71-80-69(5,6)70(7,8)81-71)53-47-58(78-43-31-27-23-19-15-11-3)51-59(48-53)79-44-32-28-24-20-16-12-4/h33-40,45-51,72,75H,9-32,41-44H2,1-8H3/b54-49-,55-49-,66-60-,66-62-,67-61-,67-63-,68-64+,68-65+ |
| InChIKey | BVZQIICJZXGZPD-DJHVHFBHSA-N |
| XLogP | 19.25 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1101.38 |
| LogP ≤ 5 | 19.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|