C65H86N4O16Si — CID 136913144
2-[10,20-bis[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]ethynyl-trimethylsilane (PubChem CID 136913144) has the molecular formula C65H86N4O16Si and a molecular weight of 1207.50 g/mol. Its IUPAC name is 2-[10,20-bis[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[10,20-bis[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 136913144 |
| Molecular Formula | C65H86N4O16Si |
| Molecular Weight | 1207.50 g/mol |
| Exact Mass | 1206.58 |
| IUPAC Name | 2-[10,20-bis[3,5-bis[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-21,23-dihydroporphyrin-5-yl]ethynyl-trimethylsilane |
| SMILES | COCCOCCOCCOc1cc(OCCOCCOCCOC)cc(-c2c3nc(c(C#C[Si](C)(C)C)c4ccc([nH]4)c(-c4cc(OCCOCCOCCOC)cc(OCCOCCOCCOC)c4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C65H86N4O16Si/c1-70-17-21-74-25-29-78-33-37-82-53-42-49(43-54(47-53)83-38-34-79-30-26-75-22-18-71-2)64-60-10-8-51(66-60)46-52-9-11-61(67-52)65(63-15-13-59(69-63)57(16-41-86(5,6)7)58-12-14-62(64)68-58)50-44-55(84-39-35-80-31-27-76-23-19-72-3)48-56(45-50)85-40-36-81-32-28-77-24-20-73-4/h8-15,42-48,66,69H,17-40H2,1-7H3/b51-46-,52-46-,58-57-,59-57-,64-60-,64-62-,65-61-,65-63- |
| InChIKey | WOBOLDNWZJNJMQ-WMWHXGRRSA-N |
| XLogP | 9.45 |
| TPSA | 205.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1207.50 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|