C60H65N5O2Si4 — CID 166568576
tert-butyl N-[3-[10,20-bis[3,5-bis(2-trimethylsilylethynyl)phenyl]-21,24-dihydroporphyrin-5-yl]prop-2-ynyl]carbamate (PubChem CID 166568576) has the molecular formula C60H65N5O2Si4 and a molecular weight of 1000.56 g/mol. Its IUPAC name is tert-butyl N-[3-[10,20-bis[3,5-bis(2-trimethylsilylethynyl)phenyl]-21,24-dihydroporphyrin-5-yl]prop-2-ynyl]carbamate.
| Compound Name | tert-butyl N-[3-[10,20-bis[3,5-bis(2-trimethylsilylethynyl)phenyl]-21,24-dihydroporphyrin-5-yl]prop-2-ynyl]carbamate |
|---|---|
| PubChem CID | 166568576 |
| Molecular Formula | C60H65N5O2Si4 |
| Molecular Weight | 1000.56 g/mol |
| Exact Mass | 999.42 |
| IUPAC Name | tert-butyl N-[3-[10,20-bis[3,5-bis(2-trimethylsilylethynyl)phenyl]-21,24-dihydroporphyrin-5-yl]prop-2-ynyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC#Cc1c2nc(c(-c3cc(C#C[Si](C)(C)C)cc(C#C[Si](C)(C)C)c3)c3nc(cc4ccc([nH]4)c(-c4cc(C#C[Si](C)(C)C)cc(C#C[Si](C)(C)C)c4)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C60H65N5O2Si4/c1-60(2,3)67-59(66)61-30-16-17-50-51-22-24-55(64-51)57(46-37-42(26-31-68(4,5)6)35-43(38-46)27-32-69(7,8)9)53-20-18-48(62-53)41-49-19-21-54(63-49)58(56-25-23-52(50)65-56)47-39-44(28-33-70(10,11)12)36-45(40-47)29-34-71(13,14)15/h18-25,35-41,62,64H,30H2,1-15H3,(H,61,66)/b48-41-,49-41-,51-50-,52-50-,57-53-,57-55-,58-54-,58-56- |
| InChIKey | QGEFJIUVJIVKBO-NQYXYXIVSA-N |
| XLogP | 13.78 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1000.56 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|