C73H79N7O4 — CID 136690897
5,15-bis[2,6-bis(3,3-dimethylbutoxy)phenyl]-10-[2-(2,6-dipyridin-2-yl-4-pyridinyl)ethynyl]-21,23-dihydroporphyrin (PubChem CID 136690897) has the molecular formula C73H79N7O4 and a molecular weight of 1118.48 g/mol. Its IUPAC name is 5,15-bis[2,6-bis(3,3-dimethylbutoxy)phenyl]-10-[2-(2,6-dipyridin-2-yl-4-pyridinyl)ethynyl]-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis[2,6-bis(3,3-dimethylbutoxy)phenyl]-10-[2-(2,6-dipyridin-2-yl-4-pyridinyl)ethynyl]-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136690897 |
| Molecular Formula | C73H79N7O4 |
| Molecular Weight | 1118.48 g/mol |
| Exact Mass | 1117.62 |
| IUPAC Name | 5,15-bis[2,6-bis(3,3-dimethylbutoxy)phenyl]-10-[2-(2,6-dipyridin-2-yl-4-pyridinyl)ethynyl]-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)CCOc1cccc(OCCC(C)(C)C)c1-c1c2nc(c(C#Cc3cc(-c4ccccn4)nc(-c4ccccn4)c3)c3ccc([nH]3)c(-c3c(OCCC(C)(C)C)cccc3OCCC(C)(C)C)c3nc(cc4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C73H79N7O4/c1-70(2,3)35-41-81-62-21-17-22-63(82-42-36-71(4,5)6)68(62)66-56-29-26-49(76-56)47-50-27-30-57(77-50)67(69-64(83-43-37-72(7,8)9)23-18-24-65(69)84-44-38-73(10,11)12)59-34-32-53(79-59)51(52-31-33-58(66)78-52)28-25-48-45-60(54-19-13-15-39-74-54)80-61(46-48)55-20-14-16-40-75-55/h13-24,26-27,29-34,39-40,45-47,76,79H,35-38,41-44H2,1-12H3/b49-47-,50-47-,52-51-,53-51-,66-56+,66-58+,67-57+,67-59+ |
| InChIKey | KEUTWHDKJGATHK-GVVHMKSCSA-N |
| XLogP | 18.17 |
| TPSA | 132.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1118.48 |
| LogP ≤ 5 | 18.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|