C61H62N4Si — CID 10629493
trimethyl-[2-[4-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]ethynyl]silane (PubChem CID 10629493) has the molecular formula C61H62N4Si and a molecular weight of 879.28 g/mol. Its IUPAC name is trimethyl-[2-[4-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[4-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 10629493 |
| Molecular Formula | C61H62N4Si |
| Molecular Weight | 879.28 g/mol |
| Exact Mass | 878.47 |
| IUPAC Name | trimethyl-[2-[4-[10,15,20-tris(4-tert-butylphenyl)-23,24-dihydroporphyrin-5-yl]phenyl]ethynyl]silane |
| SMILES | CC(C)(C)c1ccc(-c2c3nc(c(-c4ccc(C#C[Si](C)(C)C)cc4)c4nc(c(-c5ccc(C(C)(C)C)cc5)c5ccc([nH]5)c(-c5ccc(C(C)(C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C61H62N4Si/c1-59(2,3)44-23-17-41(18-24-44)56-49-31-29-47(62-49)55(40-15-13-39(14-16-40)37-38-66(10,11)12)48-30-32-50(63-48)57(42-19-25-45(26-20-42)60(4,5)6)52-34-36-54(65-52)58(53-35-33-51(56)64-53)43-21-27-46(28-22-43)61(7,8)9/h13-36,64-65H,1-12H3/b55-47-,55-48-,56-49-,56-51-,57-50-,57-52-,58-53-,58-54- |
| InChIKey | WUFKXSLWMJGHKZ-MXRZNNOWSA-N |
| XLogP | 16.44 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.28 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|