C46H56N4Si — CID 11181806
trimethyl-[2-[4-(10,15,20-tripentyl-21,22-dihydroporphyrin-5-yl)phenyl]ethynyl]silane (PubChem CID 11181806) has the molecular formula C46H56N4Si and a molecular weight of 693.07 g/mol. Its IUPAC name is trimethyl-[2-[4-(10,15,20-tripentyl-21,22-dihydroporphyrin-5-yl)phenyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[4-(10,15,20-tripentyl-21,22-dihydroporphyrin-5-yl)phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 11181806 |
| Molecular Formula | C46H56N4Si |
| Molecular Weight | 693.07 g/mol |
| Exact Mass | 692.43 |
| IUPAC Name | trimethyl-[2-[4-(10,15,20-tripentyl-21,22-dihydroporphyrin-5-yl)phenyl]ethynyl]silane |
| SMILES | CCCCCc1c2nc(c(CCCCC)c3ccc([nH]3)c(-c3ccc(C#C[Si](C)(C)C)cc3)c3ccc([nH]3)c(CCCCC)c3nc1C=C3)C=C2 |
| InChI | InChI=1S/C46H56N4Si/c1-7-10-13-16-35-38-23-25-40(47-38)36(17-14-11-8-2)42-27-29-44(49-42)46(34-21-19-33(20-22-34)31-32-51(4,5)6)45-30-28-43(50-45)37(18-15-12-9-3)41-26-24-39(35)48-41/h19-30,49-50H,7-18H2,1-6H3/b38-35-,39-35-,40-36-,41-37-,42-36-,43-37-,46-44-,46-45- |
| InChIKey | IORHJHNMCUTBFM-AOMHHNRMSA-N |
| XLogP | 12.75 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.07 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|