C36H46CrN4 — CID 158233233
chromium;5,10,15,20-tetrabutyl-21,22-dihydroporphyrin (PubChem CID 158233233) has the molecular formula C36H46CrN4 and a molecular weight of 586.79 g/mol. Its IUPAC name is chromium;5,10,15,20-tetrabutyl-21,22-dihydroporphyrin.
| Compound Name | chromium;5,10,15,20-tetrabutyl-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 158233233 |
| Molecular Formula | C36H46CrN4 |
| Molecular Weight | 586.79 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | chromium;5,10,15,20-tetrabutyl-21,22-dihydroporphyrin |
| SMILES | CCCCc1c2nc(c(CCCC)c3ccc([nH]3)c(CCCC)c3ccc([nH]3)c(CCCC)c3nc1C=C3)C=C2.[Cr] |
| InChI | InChI=1S/C36H46N4.Cr/c1-5-9-13-25-29-17-19-31(37-29)26(14-10-6-2)33-21-23-35(39-33)28(16-12-8-4)36-24-22-34(40-36)27(15-11-7-3)32-20-18-30(25)38-32;/h17-24,37-38H,5-16H2,1-4H3;/b29-25-,30-25-,31-26-,32-27-,33-26-,34-27-,35-28-,36-28-; |
| InChIKey | NNHFSECTHCEWJX-NZXKTWFISA-N |
| XLogP | 10.02 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.79 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |