C68H86N8+4 — CID 101073151
5,10,15,20-tetrakis(7-pyridin-1-ium-1-ylheptyl)-21,22-dihydroporphyrin (PubChem CID 101073151) has the molecular formula C68H86N8+4 and a molecular weight of 1015.49 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(7-pyridin-1-ium-1-ylheptyl)-21,22-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(7-pyridin-1-ium-1-ylheptyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 101073151 |
| Molecular Formula | C68H86N8+4 |
| Molecular Weight | 1015.49 g/mol |
| Exact Mass | 1014.70 |
| IUPAC Name | 5,10,15,20-tetrakis(7-pyridin-1-ium-1-ylheptyl)-21,22-dihydroporphyrin |
| SMILES | C1=Cc2nc1c(CCCCCCC[n+]1ccccc1)c1nc(c(CCCCCCC[n+]3ccccc3)c3ccc([nH]3)c(CCCCCCC[n+]3ccccc3)c3ccc([nH]3)c2CCCCCCC[n+]2ccccc2)C=C1 |
| InChI | InChI=1S/C68H86N8/c1(9-21-45-73-49-25-13-26-50-73)5-17-33-57-61-37-39-63(69-61)58(34-18-6-2-10-22-46-74-51-27-14-28-52-74)65-41-43-67(71-65)60(36-20-8-4-12-24-48-76-55-31-16-32-56-76)68-44-42-66(72-68)59(64-40-38-62(57)70-64)35-19-7-3-11-23-47-75-53-29-15-30-54-75/h13-16,25-32,37-44,49-56,69-70H,1-12,17-24,33-36,45-48H2/q+4/b61-57-,62-57-,63-58-,64-59-,65-58-,66-59-,67-60-,68-60- |
| InChIKey | TYFJNWAENICGLJ-IJVYCDDVSA-N |
| XLogP | 14.58 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1015.49 |
| LogP ≤ 5 | 14.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|