C48H54N4 — CID 10699782
10,20-dipentyl-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin (PubChem CID 10699782) has the molecular formula C48H54N4 and a molecular weight of 686.99 g/mol. Its IUPAC name is 10,20-dipentyl-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,20-dipentyl-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10699782 |
| Molecular Formula | C48H54N4 |
| Molecular Weight | 686.99 g/mol |
| Exact Mass | 686.43 |
| IUPAC Name | 10,20-dipentyl-5,15-bis(2,4,6-trimethylphenyl)-21,22-dihydroporphyrin |
| SMILES | CCCCCc1c2nc(c(-c3c(C)cc(C)cc3C)c3nc(c(CCCCC)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C48H54N4/c1-9-11-13-15-35-37-17-21-41(49-37)47(45-31(5)25-29(3)26-32(45)6)43-23-19-39(51-43)36(16-14-12-10-2)40-20-24-44(52-40)48(42-22-18-38(35)50-42)46-33(7)27-30(4)28-34(46)8/h17-28,49,51H,9-16H2,1-8H3/b37-35-,38-35-,39-36-,40-36-,47-41+,47-43+,48-42+,48-44+ |
| InChIKey | AQOCGGFMQRZNNQ-ZZHRWBJXSA-N |
| XLogP | 13.31 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.99 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|