C36H32N4S — CID 102221559
6,16-bis(2,4,6-trimethylphenyl)-11-thia-20,21,22,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(19),2,4,6,8,10(22),12(21),13,15,17-decaene (PubChem CID 102221559) has the molecular formula C36H32N4S and a molecular weight of 552.75 g/mol. Its IUPAC name is 6,16-bis(2,4,6-trimethylphenyl)-11-thia-20,21,22,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(19),2,4,6,8,10(22),12(21),13,15,17-decaene.
| Compound Name | 6,16-bis(2,4,6-trimethylphenyl)-11-thia-20,21,22,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(19),2,4,6,8,10(22),12(21),13,15,17-decaene |
|---|---|
| PubChem CID | 102221559 |
| Molecular Formula | C36H32N4S |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | 6,16-bis(2,4,6-trimethylphenyl)-11-thia-20,21,22,23-tetrazapentacyclo[15.2.1.12,5.17,10.112,15]tricosa-1(19),2,4,6,8,10(22),12(21),13,15,17-decaene |
| SMILES | Cc1cc(C)c(-c2c3nc(sc4nc(c(-c5c(C)cc(C)cc5C)c5ccc([nH]5)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C36H32N4S/c1-19-15-21(3)33(22(4)16-19)35-27-9-7-25(37-27)26-8-10-28(38-26)36(34-23(5)17-20(2)18-24(34)6)30-12-14-32(40-30)41-31-13-11-29(35)39-31/h7-18,37-38H,1-6H3/b35-29+,36-30+ |
| InChIKey | XNEYCBBYUGKKOV-ZRBLUKEISA-N |
| XLogP | 9.90 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |