C60H66N8 — CID 137081692
N,N,3,5-tetramethyl-4-[10,15,20-tris[4-(dimethylamino)-2,6-dimethylphenyl]-21,23-dihydroporphyrin-5-yl]aniline (PubChem CID 137081692) has the molecular formula C60H66N8 and a molecular weight of 899.24 g/mol. Its IUPAC name is N,N,3,5-tetramethyl-4-[10,15,20-tris[4-(dimethylamino)-2,6-dimethylphenyl]-21,23-dihydroporphyrin-5-yl]aniline.
| Compound Name | N,N,3,5-tetramethyl-4-[10,15,20-tris[4-(dimethylamino)-2,6-dimethylphenyl]-21,23-dihydroporphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 137081692 |
| Molecular Formula | C60H66N8 |
| Molecular Weight | 899.24 g/mol |
| Exact Mass | 898.54 |
| IUPAC Name | N,N,3,5-tetramethyl-4-[10,15,20-tris[4-(dimethylamino)-2,6-dimethylphenyl]-21,23-dihydroporphyrin-5-yl]aniline |
| SMILES | Cc1cc(N(C)C)cc(C)c1-c1c2nc(c(-c3c(C)cc(N(C)C)cc3C)c3ccc([nH]3)c(-c3c(C)cc(N(C)C)cc3C)c3nc(c(-c4c(C)cc(N(C)C)cc4C)c4ccc1[nH]4)C=C3)C=C2 |
| InChI | InChI=1S/C60H66N8/c1-33-25-41(65(9)10)26-34(2)53(33)57-45-17-19-47(61-45)58(54-35(3)27-42(66(11)12)28-36(54)4)49-21-23-51(63-49)60(56-39(7)31-44(68(15)16)32-40(56)8)52-24-22-50(64-52)59(48-20-18-46(57)62-48)55-37(5)29-43(67(13)14)30-38(55)6/h17-32,61,64H,1-16H3/b57-45+,57-46+,58-47+,58-49+,59-48+,59-50+,60-51+,60-52+ |
| InChIKey | XCKLBPYIIFUMSF-YDHMRBOZSA-N |
| XLogP | 14.05 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.24 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |