C47H43BrN4 — CID 135545252
5-bromo-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin (PubChem CID 135545252) has the molecular formula C47H43BrN4 and a molecular weight of 743.79 g/mol. Its IUPAC name is 5-bromo-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-bromo-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135545252 |
| Molecular Formula | C47H43BrN4 |
| Molecular Weight | 743.79 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | 5-bromo-10,15,20-tris(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c(Br)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C47H43BrN4/c1-24-18-27(4)41(28(5)19-24)44-33-10-12-35(49-33)45(42-29(6)20-25(2)21-30(42)7)37-14-16-39(51-37)47(48)40-17-15-38(52-40)46(36-13-11-34(44)50-36)43-31(8)22-26(3)23-32(43)9/h10-23,49,52H,1-9H3/b44-33+,44-34+,45-35+,45-37+,46-36+,46-38+,47-39+,47-40+ |
| InChIKey | OFPZXXIWONOUPQ-GFMVYPLISA-N |
| XLogP | 13.19 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.79 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |