C36H27BrN4O — CID 135964269
4-[20-bromo-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde (PubChem CID 135964269) has the molecular formula C36H27BrN4O and a molecular weight of 611.54 g/mol. Its IUPAC name is 4-[20-bromo-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[20-bromo-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 135964269 |
| Molecular Formula | C36H27BrN4O |
| Molecular Weight | 611.54 g/mol |
| Exact Mass | 610.14 |
| IUPAC Name | 4-[20-bromo-15-(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
| SMILES | Cc1cc(C)c(-c2c3nc(c(Br)c4ccc([nH]4)c(-c4ccc(C=O)cc4)c4nc(cc5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C36H27BrN4O/c1-20-16-21(2)33(22(3)17-20)35-29-11-9-26(39-29)18-25-8-10-27(38-25)34(24-6-4-23(19-42)5-7-24)28-12-14-31(40-28)36(37)32-15-13-30(35)41-32/h4-19,39-40H,1-3H3/b25-18-,26-18-,34-27-,34-28-,35-29+,35-30+,36-31+,36-32+ |
| InChIKey | OEBIKEXWOTVNHT-RHJRGFLMSA-N |
| XLogP | 9.49 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.54 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|