C45H15F15N4O — CID 136915978
4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde (PubChem CID 136915978) has the molecular formula C45H15F15N4O and a molecular weight of 912.61 g/mol. Its IUPAC name is 4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 136915978 |
| Molecular Formula | C45H15F15N4O |
| Molecular Weight | 912.61 g/mol |
| Exact Mass | 912.10 |
| IUPAC Name | 4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
| SMILES | O=Cc1ccc(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C45H15F15N4O/c46-31-28(32(47)38(53)43(58)37(31)52)25-18-7-5-16(61-18)24(15-3-1-14(13-65)2-4-15)17-6-8-19(62-17)26(29-33(48)39(54)44(59)40(55)34(29)49)21-10-12-23(64-21)27(22-11-9-20(25)63-22)30-35(50)41(56)45(60)42(57)36(30)51/h1-13,61,64H/b24-16-,24-17-,25-18+,25-20+,26-19+,26-21+,27-22+,27-23+ |
| InChIKey | KZAMQJCBUZTSIR-BFZDCEKXSA-N |
| XLogP | 13.22 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.61 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|