C49H42N6O — CID 136805827
4-[15-(1-methylimidazol-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde (PubChem CID 136805827) has the molecular formula C49H42N6O and a molecular weight of 730.92 g/mol. Its IUPAC name is 4-[15-(1-methylimidazol-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde.
| Compound Name | 4-[15-(1-methylimidazol-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 136805827 |
| Molecular Formula | C49H42N6O |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.34 |
| IUPAC Name | 4-[15-(1-methylimidazol-2-yl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]benzaldehyde |
| SMILES | Cc1cc(C)c(-c2c3nc(c(-c4nccn4C)c4ccc([nH]4)c(-c4c(C)cc(C)cc4C)c4nc(c(-c5ccc(C=O)cc5)c5ccc2[nH]5)C=C4)C=C3)c(C)c1 |
| InChI | InChI=1S/C49H42N6O/c1-27-22-29(3)43(30(4)23-27)46-37-14-12-35(51-37)45(34-10-8-33(26-56)9-11-34)36-13-15-38(52-36)47(44-31(5)24-28(2)25-32(44)6)40-17-19-42(54-40)48(41-18-16-39(46)53-41)49-50-20-21-55(49)7/h8-26,51,54H,1-7H3/b45-35-,45-36-,46-37+,46-39+,47-38+,47-40+,48-41+,48-42+ |
| InChIKey | XICWZFUXKDNXJY-OJQSIJCKSA-N |
| XLogP | 11.72 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|