C48H42N4O2S — CID 135489289
S-[[4-[15-formyl-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate (PubChem CID 135489289) has the molecular formula C48H42N4O2S and a molecular weight of 738.96 g/mol. Its IUPAC name is S-[[4-[15-formyl-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate.
| Compound Name | S-[[4-[15-formyl-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 135489289 |
| Molecular Formula | C48H42N4O2S |
| Molecular Weight | 738.96 g/mol |
| Exact Mass | 738.30 |
| IUPAC Name | S-[[4-[15-formyl-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(C=O)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H42N4O2S/c1-26-20-28(3)44(29(4)21-26)47-40-14-12-36(49-40)35(24-53)37-13-15-41(50-37)48(45-30(5)22-27(2)23-31(45)6)43-19-17-39(52-43)46(38-16-18-42(47)51-38)34-10-8-33(9-11-34)25-55-32(7)54/h8-24,49,52H,25H2,1-7H3/b36-35-,37-35-,46-38-,46-39-,47-40+,47-42+,48-41+,48-43+ |
| InChIKey | MMMQQWIWYGWUFP-CZDGZMTGSA-N |
| XLogP | 12.10 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.96 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|