C53H45IN4OS — CID 136693237
S-[[4-[15-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate (PubChem CID 136693237) has the molecular formula C53H45IN4OS and a molecular weight of 912.94 g/mol. Its IUPAC name is S-[[4-[15-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate.
| Compound Name | S-[[4-[15-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate |
|---|---|
| PubChem CID | 136693237 |
| Molecular Formula | C53H45IN4OS |
| Molecular Weight | 912.94 g/mol |
| Exact Mass | 912.24 |
| IUPAC Name | S-[[4-[15-(4-iodophenyl)-10,20-bis(2,4,6-trimethylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]methyl] ethanethioate |
| SMILES | CC(=O)SCc1ccc(-c2c3nc(c(-c4c(C)cc(C)cc4C)c4ccc([nH]4)c(-c4ccc(I)cc4)c4nc(c(-c5c(C)cc(C)cc5C)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C53H45IN4OS/c1-29-24-31(3)48(32(4)25-29)52-44-20-16-40(55-44)50(37-10-8-36(9-11-37)28-60-35(7)59)41-17-21-45(56-41)53(49-33(5)26-30(2)27-34(49)6)47-23-19-43(58-47)51(42-18-22-46(52)57-42)38-12-14-39(54)15-13-38/h8-27,55,58H,28H2,1-7H3/b50-40-,50-41-,51-42-,51-43-,52-44+,52-46+,53-45+,53-47+ |
| InChIKey | DECZJLPPVVLLEY-WTVSBRKVSA-N |
| XLogP | 14.56 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.94 |
| LogP ≤ 5 | 14.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|