C54H42N4O — CID 135508187
[4-[4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phenyl]methanol (PubChem CID 135508187) has the molecular formula C54H42N4O and a molecular weight of 762.96 g/mol. Its IUPAC name is [4-[4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phenyl]methanol.
| Compound Name | [4-[4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phenyl]methanol |
|---|---|
| PubChem CID | 135508187 |
| Molecular Formula | C54H42N4O |
| Molecular Weight | 762.96 g/mol |
| Exact Mass | 762.34 |
| IUPAC Name | [4-[4-[10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phenyl]methanol |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(-c5ccc(CO)cc5)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C54H42N4O/c1-33-4-12-39(13-5-33)51-43-24-26-45(55-43)52(40-14-6-34(2)7-15-40)47-28-30-49(57-47)54(42-22-20-38(21-23-42)37-18-10-36(32-59)11-19-37)50-31-29-48(58-50)53(46-27-25-44(51)56-46)41-16-8-35(3)9-17-41/h4-31,55,58-59H,32H2,1-3H3/b51-43-,51-44-,52-45-,52-47-,53-46-,53-48-,54-49-,54-50- |
| InChIKey | IBWPWHUXWGFGJE-FLZKLWFOSA-N |
| XLogP | 13.41 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.96 |
| LogP ≤ 5 | 13.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |