C46H36N4O6P2 — CID 136948391
[4-[10,20-bis(4-methylphenyl)-15-(4-phosphonophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phosphonic acid (PubChem CID 136948391) has the molecular formula C46H36N4O6P2 and a molecular weight of 802.76 g/mol. Its IUPAC name is [4-[10,20-bis(4-methylphenyl)-15-(4-phosphonophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phosphonic acid.
| Compound Name | [4-[10,20-bis(4-methylphenyl)-15-(4-phosphonophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phosphonic acid |
|---|---|
| PubChem CID | 136948391 |
| Molecular Formula | C46H36N4O6P2 |
| Molecular Weight | 802.76 g/mol |
| Exact Mass | 802.21 |
| IUPAC Name | [4-[10,20-bis(4-methylphenyl)-15-(4-phosphonophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]phosphonic acid |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(P(=O)(O)O)cc4)c4ccc([nH]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(P(=O)(O)O)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H36N4O6P2/c1-27-3-7-29(8-4-27)43-35-19-23-39(47-35)45(31-11-15-33(16-12-31)57(51,52)53)41-25-21-37(49-41)44(30-9-5-28(2)6-10-30)38-22-26-42(50-38)46(40-24-20-36(43)48-40)32-13-17-34(18-14-32)58(54,55)56/h3-26,47,50H,1-2H3,(H2,51,52,53)(H2,54,55,56)/b43-35-,43-36-,44-37-,44-38-,45-39-,45-41-,46-40-,46-42- |
| InChIKey | LQTBJWLABYHRAY-ZTRVSJDYSA-N |
| XLogP | 9.55 |
| TPSA | 172.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.76 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|