C47H35N7 — CID 135863073
5-(4-azidophenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin (PubChem CID 135863073) has the molecular formula C47H35N7 and a molecular weight of 697.85 g/mol. Its IUPAC name is 5-(4-azidophenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(4-azidophenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135863073 |
| Molecular Formula | C47H35N7 |
| Molecular Weight | 697.85 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | 5-(4-azidophenyl)-10,15,20-tris(4-methylphenyl)-21,23-dihydroporphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(N=[N+]=[N-])cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C47H35N7/c1-28-4-10-31(11-5-28)44-36-20-22-38(49-36)45(32-12-6-29(2)7-13-32)40-24-26-42(51-40)47(34-16-18-35(19-17-34)53-54-48)43-27-25-41(52-43)46(39-23-21-37(44)50-39)33-14-8-30(3)9-15-33/h4-27,49,52H,1-3H3/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | AEHNDNOJVMCXOW-ZQANTMHOSA-N |
| XLogP | 13.19 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.85 |
| LogP ≤ 5 | 13.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|