C44H14F15N7 — CID 162352982
5-(4-azidophenyl)-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin (PubChem CID 162352982) has the molecular formula C44H14F15N7 and a molecular weight of 925.61 g/mol. Its IUPAC name is 5-(4-azidophenyl)-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(4-azidophenyl)-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 162352982 |
| Molecular Formula | C44H14F15N7 |
| Molecular Weight | 925.61 g/mol |
| Exact Mass | 925.11 |
| IUPAC Name | 5-(4-azidophenyl)-10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin |
| SMILES | [N-]=[N+]=Nc1ccc(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(F)c(F)c4F)c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H14F15N7/c45-30-27(31(46)37(52)42(57)36(30)51)24-17-7-5-15(61-17)23(13-1-3-14(4-2-13)65-66-60)16-6-8-18(62-16)25(28-32(47)38(53)43(58)39(54)33(28)48)20-10-12-22(64-20)26(21-11-9-19(24)63-21)29-34(49)40(55)44(59)41(56)35(29)50/h1-12,61,64H/b23-15-,23-16-,24-17+,24-19+,25-18+,25-20+,26-21+,26-22+ |
| InChIKey | MOSKREIUNNVWQF-KWJSPENUSA-N |
| XLogP | 14.35 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.61 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|