C49H40N4 — CID 11125302
23-methyl-5,10,15,20-tetrakis(4-methylphenyl)-21H-porphyrin (PubChem CID 11125302) has the molecular formula C49H40N4 and a molecular weight of 684.89 g/mol. Its IUPAC name is 23-methyl-5,10,15,20-tetrakis(4-methylphenyl)-21H-porphyrin.
| Compound Name | 23-methyl-5,10,15,20-tetrakis(4-methylphenyl)-21H-porphyrin |
|---|---|
| PubChem CID | 11125302 |
| Molecular Formula | C49H40N4 |
| Molecular Weight | 684.89 g/mol |
| Exact Mass | 684.33 |
| IUPAC Name | 23-methyl-5,10,15,20-tetrakis(4-methylphenyl)-21H-porphyrin |
| SMILES | Cc1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc(c(-c5ccc(C)cc5)c5nc(c(-c6ccc(C)cc6)c6ccc2[nH]6)C=C5)n4C)C=C3)cc1 |
| InChI | InChI=1S/C49H40N4/c1-30-6-14-34(15-7-30)46-38-22-23-39(50-38)47(35-16-8-31(2)9-17-35)41-25-27-43(52-41)49(37-20-12-33(4)13-21-37)45-29-28-44(53(45)5)48(42-26-24-40(46)51-42)36-18-10-32(3)11-19-36/h6-29,50H,1-5H3/b46-38-,46-40-,47-39-,47-41-,48-42-,48-44-,49-43-,49-45- |
| InChIKey | CKTXLYRPUYQTRJ-MIAJBZRJSA-N |
| XLogP | 12.57 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.89 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |