C51H37N5O2S — CID 15452897
4-methyl-N-(5,10,15,20-tetraphenyl-23H-porphyrin-21-yl)benzenesulfonamide (PubChem CID 15452897) has the molecular formula C51H37N5O2S and a molecular weight of 783.96 g/mol. Its IUPAC name is 4-methyl-N-(5,10,15,20-tetraphenyl-23H-porphyrin-21-yl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(5,10,15,20-tetraphenyl-23H-porphyrin-21-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 15452897 |
| Molecular Formula | C51H37N5O2S |
| Molecular Weight | 783.96 g/mol |
| Exact Mass | 783.27 |
| IUPAC Name | 4-methyl-N-(5,10,15,20-tetraphenyl-23H-porphyrin-21-yl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nn2c3ccc2c(-c2ccccc2)c2nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c3-c3ccccc3)C=C4)C=C2)cc1 |
| InChI | InChI=1S/C51H37N5O2S/c1-34-22-24-39(25-23-34)59(57,58)55-56-46-32-33-47(56)51(38-20-12-5-13-21-38)45-31-29-43(54-45)49(36-16-8-3-9-17-36)41-27-26-40(52-41)48(35-14-6-2-7-15-35)42-28-30-44(53-42)50(46)37-18-10-4-11-19-37/h2-33,52,55H,1H3/b48-40-,48-42-,49-41-,49-43-,50-44-,50-46-,51-45-,51-47- |
| InChIKey | CPHOKPRDNTURNG-QMTQPZJVSA-N |
| XLogP | 12.04 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.96 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |