C46H36N6 — CID 135909432
5-N,15-N-bis(4-methylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5,15-diamine (PubChem CID 135909432) has the molecular formula C46H36N6 and a molecular weight of 672.84 g/mol. Its IUPAC name is 5-N,15-N-bis(4-methylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5,15-diamine.
| Compound Name | 5-N,15-N-bis(4-methylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5,15-diamine |
|---|---|
| PubChem CID | 135909432 |
| Molecular Formula | C46H36N6 |
| Molecular Weight | 672.84 g/mol |
| Exact Mass | 672.30 |
| IUPAC Name | 5-N,15-N-bis(4-methylphenyl)-10,20-diphenyl-21,23-dihydroporphyrin-5,15-diamine |
| SMILES | Cc1ccc(Nc2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(Nc4ccc(C)cc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H36N6/c1-29-13-17-33(18-14-29)47-45-39-25-21-35(49-39)43(31-9-5-3-6-10-31)37-23-27-41(51-37)46(48-34-19-15-30(2)16-20-34)42-28-24-38(52-42)44(32-11-7-4-8-12-32)36-22-26-40(45)50-36/h3-28,47-49,52H,1-2H3/b43-35-,43-37-,44-36-,44-38-,45-39+,45-40+,46-41+,46-42+ |
| InChIKey | GAFVXRUSSPKEOM-UDSHDLGUSA-N |
| XLogP | 12.09 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.84 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |