C44H30ClN5 — CID 135909496
N-(4-chlorophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin-5-amine (PubChem CID 135909496) has the molecular formula C44H30ClN5 and a molecular weight of 664.21 g/mol. Its IUPAC name is N-(4-chlorophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin-5-amine.
| Compound Name | N-(4-chlorophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin-5-amine |
|---|---|
| PubChem CID | 135909496 |
| Molecular Formula | C44H30ClN5 |
| Molecular Weight | 664.21 g/mol |
| Exact Mass | 663.22 |
| IUPAC Name | N-(4-chlorophenyl)-10,15,20-triphenyl-21,23-dihydroporphyrin-5-amine |
| SMILES | Clc1ccc(Nc2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H30ClN5/c45-31-16-18-32(19-17-31)46-44-39-26-24-37(49-39)42(29-12-6-2-7-13-29)35-22-20-33(47-35)41(28-10-4-1-5-11-28)34-21-23-36(48-34)43(30-14-8-3-9-15-30)38-25-27-40(44)50-38/h1-27,46-47,50H/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39+,44-40+ |
| InChIKey | AVCMQRCIOFTLMY-JHFQPPSTSA-N |
| XLogP | 12.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.21 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |