C33H23N5O2 — CID 136683340
N-(4-nitrophenyl)-7,12-diphenyl-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaen-2-amine (PubChem CID 136683340) has the molecular formula C33H23N5O2 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-(4-nitrophenyl)-7,12-diphenyl-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaen-2-amine.
| Compound Name | N-(4-nitrophenyl)-7,12-diphenyl-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaen-2-amine |
|---|---|
| PubChem CID | 136683340 |
| Molecular Formula | C33H23N5O2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-(4-nitrophenyl)-7,12-diphenyl-16,17,18-triazatetracyclo[11.2.1.13,6.18,11]octadeca-1,3,5,7,9,11,13(16),14-octaen-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4ccc2[nH]4)C=C3)cc1 |
| InChI | InChI=1S/C33H23N5O2/c39-38(40)24-13-11-23(12-14-24)34-33-29-19-17-27(36-29)31(21-7-3-1-4-8-21)25-15-16-26(35-25)32(22-9-5-2-6-10-22)28-18-20-30(33)37-28/h1-20,34-36H/b31-25-,31-27-,32-26+,32-28+,33-29+,33-30+ |
| InChIKey | UHUHYNLMAIDRNY-OIURFGHHSA-N |
| XLogP | 8.64 |
| TPSA | 99.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|