C44H29N8O6+ — CID 155923984
5-(1-methylpyridin-1-ium-4-yl)-10,15,20-tris(4-nitrophenyl)-21,23-dihydroporphyrin (PubChem CID 155923984) has the molecular formula C44H29N8O6+ and a molecular weight of 765.77 g/mol. Its IUPAC name is 5-(1-methylpyridin-1-ium-4-yl)-10,15,20-tris(4-nitrophenyl)-21,23-dihydroporphyrin.
| Compound Name | 5-(1-methylpyridin-1-ium-4-yl)-10,15,20-tris(4-nitrophenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 155923984 |
| Molecular Formula | C44H29N8O6+ |
| Molecular Weight | 765.77 g/mol |
| Exact Mass | 765.22 |
| IUPAC Name | 5-(1-methylpyridin-1-ium-4-yl)-10,15,20-tris(4-nitrophenyl)-21,23-dihydroporphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4ccc([N+](=O)[O-])cc4)c4ccc([nH]4)c(-c4ccc([N+](=O)[O-])cc4)c4nc(c(-c5ccc([N+](=O)[O-])cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H28N8O6/c1-49-24-22-29(23-25-49)44-39-20-18-37(47-39)42(27-4-10-31(11-5-27)51(55)56)35-16-14-33(45-35)41(26-2-8-30(9-3-26)50(53)54)34-15-17-36(46-34)43(38-19-21-40(44)48-38)28-6-12-32(13-7-28)52(57)58/h2-25H,1H3,(H,45,46,47,48)/p+1 |
| InChIKey | VLYNMMVYYPHKAN-UHFFFAOYSA-O |
| XLogP | 9.87 |
| TPSA | 190.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.77 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|