C48H35N5O6 — CID 135536094
methyl 4-[10,20-bis(4-methoxyphenyl)-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135536094) has the molecular formula C48H35N5O6 and a molecular weight of 777.84 g/mol. Its IUPAC name is methyl 4-[10,20-bis(4-methoxyphenyl)-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[10,20-bis(4-methoxyphenyl)-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135536094 |
| Molecular Formula | C48H35N5O6 |
| Molecular Weight | 777.84 g/mol |
| Exact Mass | 777.26 |
| IUPAC Name | methyl 4-[10,20-bis(4-methoxyphenyl)-15-(4-nitrophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccc(OC)cc4)c4ccc([nH]4)c(-c4ccc([N+](=O)[O-])cc4)c4nc(c(-c5ccc(OC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C48H35N5O6/c1-57-34-16-10-30(11-17-34)46-40-24-20-36(49-40)44(28-4-6-32(7-5-28)48(54)59-3)37-21-25-41(50-37)47(31-12-18-35(58-2)19-13-31)43-27-23-39(52-43)45(38-22-26-42(46)51-38)29-8-14-33(15-9-29)53(55)56/h4-27,49,52H,1-3H3/b44-36-,44-37-,45-38-,45-39-,46-40-,46-42-,47-41-,47-43- |
| InChIKey | JZWYMUPWBSYHGD-GUTUUKJPSA-N |
| XLogP | 11.04 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.84 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|