C44H34N6O4S2+2 — CID 135988608
methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(3-methyl-1,3-thiazol-3-ium-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135988608) has the molecular formula C44H34N6O4S2+2 and a molecular weight of 774.93 g/mol. Its IUPAC name is methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(3-methyl-1,3-thiazol-3-ium-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(3-methyl-1,3-thiazol-3-ium-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135988608 |
| Molecular Formula | C44H34N6O4S2+2 |
| Molecular Weight | 774.93 g/mol |
| Exact Mass | 774.21 |
| IUPAC Name | methyl 4-[15-(4-methoxycarbonylphenyl)-10,20-bis(3-methyl-1,3-thiazol-3-ium-2-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4scc[n+]4C)c4ccc([nH]4)c(-c4ccc(C(=O)OC)cc4)c4nc(c(-c5scc[n+]5C)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C44H33N6O4S2/c1-49-21-23-55-41(49)39-33-17-13-29(45-33)37(25-5-9-27(10-6-25)43(51)53-3)31-15-19-35(47-31)40(42-50(2)22-24-56-42)36-20-16-32(48-36)38(30-14-18-34(39)46-30)26-7-11-28(12-8-26)44(52)54-4/h5-24H,1-4H3,(H,45,46,47,48)/q+1/p+1/b37-29-,37-31-,38-30-,38-32-,39-33+,39-34+,40-35+,40-36+ |
| InChIKey | XJEGZFWCTHVJPB-JRUCMOTOSA-O |
| XLogP | 8.67 |
| TPSA | 117.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.93 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|