C52H42N4O4 — CID 136859874
ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136859874) has the molecular formula C52H42N4O4 and a molecular weight of 786.93 g/mol. Its IUPAC name is ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136859874 |
| Molecular Formula | C52H42N4O4 |
| Molecular Weight | 786.93 g/mol |
| Exact Mass | 786.32 |
| IUPAC Name | ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(4-methylphenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OCC)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C52H42N4O4/c1-5-59-51(57)37-19-15-35(16-20-37)49-43-27-23-39(53-43)47(33-11-7-31(3)8-12-33)41-25-29-45(55-41)50(36-17-21-38(22-18-36)52(58)60-6-2)46-30-26-42(56-46)48(40-24-28-44(49)54-40)34-13-9-32(4)10-14-34/h7-30,53,56H,5-6H2,1-4H3/b47-39-,47-41-,48-40-,48-42-,49-43-,49-44-,50-45-,50-46- |
| InChIKey | OTBGEQQJBBMBJV-CGBDAEPUSA-N |
| XLogP | 12.29 |
| TPSA | 109.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.93 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |