C54H40N6O4 — CID 154583991
ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(1H-indol-6-yl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 154583991) has the molecular formula C54H40N6O4 and a molecular weight of 836.95 g/mol. Its IUPAC name is ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(1H-indol-6-yl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(1H-indol-6-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 154583991 |
| Molecular Formula | C54H40N6O4 |
| Molecular Weight | 836.95 g/mol |
| Exact Mass | 836.31 |
| IUPAC Name | ethyl 4-[15-(4-ethoxycarbonylphenyl)-10,20-bis(1H-indol-6-yl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c3nc(c(-c4ccc5cc[nH]c5c4)c4ccc([nH]4)c(-c4ccc(C(=O)OCC)cc4)c4nc(c(-c5ccc6cc[nH]c6c5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C54H40N6O4/c1-3-63-53(61)35-11-7-33(8-12-35)49-39-17-21-43(57-39)51(37-15-5-31-25-27-55-47(31)29-37)45-23-19-41(59-45)50(34-9-13-36(14-10-34)54(62)64-4-2)42-20-24-46(60-42)52(44-22-18-40(49)58-44)38-16-6-32-26-28-56-48(32)30-38/h5-30,55-57,60H,3-4H2,1-2H3/b49-39-,49-40-,50-41-,50-42-,51-43-,51-45-,52-44-,52-46- |
| InChIKey | BKRXNLXTVKSIIL-YTJYWMACSA-N |
| XLogP | 12.64 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.95 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |