C68H74N8O8 — CID 135488197
3-(dimethylamino)propyl 4-[10,15,20-tris[4-[3-(dimethylamino)propoxycarbonyl]phenyl]-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135488197) has the molecular formula C68H74N8O8 and a molecular weight of 1131.39 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 4-[10,15,20-tris[4-[3-(dimethylamino)propoxycarbonyl]phenyl]-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | 3-(dimethylamino)propyl 4-[10,15,20-tris[4-[3-(dimethylamino)propoxycarbonyl]phenyl]-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135488197 |
| Molecular Formula | C68H74N8O8 |
| Molecular Weight | 1131.39 g/mol |
| Exact Mass | 1130.56 |
| IUPAC Name | 3-(dimethylamino)propyl 4-[10,15,20-tris[4-[3-(dimethylamino)propoxycarbonyl]phenyl]-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | CN(C)CCCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OCCCN(C)C)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OCCCN(C)C)cc4)c4nc(c(-c5ccc(C(=O)OCCCN(C)C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C68H74N8O8/c1-73(2)37-9-41-81-65(77)49-21-13-45(14-22-49)61-53-29-31-55(69-53)62(46-15-23-50(24-16-46)66(78)82-42-10-38-74(3)4)57-33-35-59(71-57)64(48-19-27-52(28-20-48)68(80)84-44-12-40-76(7)8)60-36-34-58(72-60)63(56-32-30-54(61)70-56)47-17-25-51(26-18-47)67(79)83-43-11-39-75(5)6/h13-36,69,72H,9-12,37-44H2,1-8H3/b61-53-,61-54-,62-55-,62-57-,63-56-,63-58-,64-59-,64-60- |
| InChIKey | UVJPBPVGIINYCZ-WJVFOVLXSA-N |
| XLogP | 11.76 |
| TPSA | 175.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.39 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|