C56H54N12O4 — CID 135430515
N-(2-aminoethyl)-4-[10,15,20-tris[4-(2-aminoethylcarbamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzamide (PubChem CID 135430515) has the molecular formula C56H54N12O4 and a molecular weight of 959.13 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[10,15,20-tris[4-(2-aminoethylcarbamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzamide.
| Compound Name | N-(2-aminoethyl)-4-[10,15,20-tris[4-(2-aminoethylcarbamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzamide |
|---|---|
| PubChem CID | 135430515 |
| Molecular Formula | C56H54N12O4 |
| Molecular Weight | 959.13 g/mol |
| Exact Mass | 958.44 |
| IUPAC Name | N-(2-aminoethyl)-4-[10,15,20-tris[4-(2-aminoethylcarbamoyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzamide |
| SMILES | NCCNC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)NCCN)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)NCCN)cc4)c4nc(c(-c5ccc(C(=O)NCCN)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C56H54N12O4/c57-25-29-61-53(69)37-9-1-33(2-10-37)49-41-17-19-43(65-41)50(34-3-11-38(12-4-34)54(70)62-30-26-58)45-21-23-47(67-45)52(36-7-15-40(16-8-36)56(72)64-32-28-60)48-24-22-46(68-48)51(44-20-18-42(49)66-44)35-5-13-39(14-6-35)55(71)63-31-27-59/h1-24,65,68H,25-32,57-60H2,(H,61,69)(H,62,70)(H,63,71)(H,64,72)/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | DTVSJSNYTVCVNT-RCOMQYLTSA-N |
| XLogP | 6.08 |
| TPSA | 277.84 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 959.13 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |