C72H84N5O4Si4 — CID 136826851
CID 136826851 (PubChem CID 136826851) has the molecular formula C72H84N5O4Si4 and a molecular weight of 1195.84 g/mol.
| Compound Name | CID 136826851 |
|---|---|
| PubChem CID | 136826851 |
| Molecular Formula | C72H84N5O4Si4 |
| Molecular Weight | 1195.84 g/mol |
| Exact Mass | 1194.56 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccc(C(=O)NCCC[Si](O[Si])(O[Si])O[Si])cc5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C72H84N5O4Si4/c1-67(2,3)48-34-45(35-49(40-48)68(4,5)6)63-56-26-24-54(74-56)62(43-20-22-44(23-21-43)66(78)73-32-19-33-85(79-82,80-83)81-84)55-25-27-57(75-55)64(46-36-50(69(7,8)9)41-51(37-46)70(10,11)12)59-29-31-61(77-59)65(60-30-28-58(63)76-60)47-38-52(71(13,14)15)42-53(39-47)72(16,17)18/h20-31,34-42,74,77H,19,32-33H2,1-18H3,(H,73,78)/b62-54-,62-55-,63-56-,63-58-,64-57-,64-59-,65-60-,65-61- |
| InChIKey | OXKRZIJLDSVEGN-UUERFBDCSA-N |
| XLogP | 17.47 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1195.84 |
| LogP ≤ 5 | 17.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|