C51H44N6O3 — CID 135449311
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzamide (PubChem CID 135449311) has the molecular formula C51H44N6O3 and a molecular weight of 788.95 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzamide |
|---|---|
| PubChem CID | 135449311 |
| Molecular Formula | C51H44N6O3 |
| Molecular Weight | 788.95 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)benzamide |
| SMILES | NCCOCCOCCNC(=O)c1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([nH]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C51H44N6O3/c52-28-30-59-32-33-60-31-29-53-51(58)38-18-16-37(17-19-38)50-45-26-24-43(56-45)48(35-12-6-2-7-13-35)41-22-20-39(54-41)47(34-10-4-1-5-11-34)40-21-23-42(55-40)49(36-14-8-3-9-15-36)44-25-27-46(50)57-44/h1-27,54,57H,28-33,52H2,(H,53,58)/b47-39-,47-40-,48-41-,48-43-,49-42-,49-44-,50-45-,50-46- |
| InChIKey | QNRKUNADIHSXGM-VZQFQVGISA-N |
| XLogP | 10.05 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.95 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|