C60H54N4O12 — CID 162769066
2-methoxyethyl 4-[10,15,20-tris[4-(2-methoxyethoxycarbonyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 162769066) has the molecular formula C60H54N4O12 and a molecular weight of 1023.11 g/mol. Its IUPAC name is 2-methoxyethyl 4-[10,15,20-tris[4-(2-methoxyethoxycarbonyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | 2-methoxyethyl 4-[10,15,20-tris[4-(2-methoxyethoxycarbonyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 162769066 |
| Molecular Formula | C60H54N4O12 |
| Molecular Weight | 1023.11 g/mol |
| Exact Mass | 1022.37 |
| IUPAC Name | 2-methoxyethyl 4-[10,15,20-tris[4-(2-methoxyethoxycarbonyl)phenyl]-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COCCOC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OCCOC)cc4)c4ccc([nH]4)c(-c4ccc(C(=O)OCCOC)cc4)c4nc(c(-c5ccc(C(=O)OCCOC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C60H54N4O12/c1-69-29-33-73-57(65)41-13-5-37(6-14-41)53-45-21-23-47(61-45)54(38-7-15-42(16-8-38)58(66)74-34-30-70-2)49-25-27-51(63-49)56(40-11-19-44(20-12-40)60(68)76-36-32-72-4)52-28-26-50(64-52)55(48-24-22-46(53)62-48)39-9-17-43(18-10-39)59(67)75-35-31-71-3/h5-28,61,64H,29-36H2,1-4H3/b53-45-,53-46-,54-47-,54-49-,55-48-,55-50-,56-51-,56-52- |
| InChIKey | MQSOJVVPHISWFA-YFLSTINXSA-N |
| XLogP | 10.54 |
| TPSA | 199.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.11 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|