C46H23F10N5O2 — CID 136726294
methyl 4-[15-(4-aminophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 136726294) has the molecular formula C46H23F10N5O2 and a molecular weight of 867.70 g/mol. Its IUPAC name is methyl 4-[15-(4-aminophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-aminophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 136726294 |
| Molecular Formula | C46H23F10N5O2 |
| Molecular Weight | 867.70 g/mol |
| Exact Mass | 867.17 |
| IUPAC Name | methyl 4-[15-(4-aminophenyl)-10,20-bis(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4ccc(N)cc4)c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C46H23F10N5O2/c1-63-46(62)20-4-2-18(3-5-20)30-22-10-14-26(58-22)32(34-36(47)40(51)44(55)41(52)37(34)48)28-16-12-24(60-28)31(19-6-8-21(57)9-7-19)25-13-17-29(61-25)33(27-15-11-23(30)59-27)35-38(49)42(53)45(56)43(54)39(35)50/h2-17,58,61H,57H2,1H3/b30-22-,30-23-,31-24-,31-25-,32-26+,32-28+,33-27+,33-29+ |
| InChIKey | JXHNSQDLEJGJDI-XOLXSKNWSA-N |
| XLogP | 12.08 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.70 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|