C53H20F15N5O — CID 137275788
4-[2-[4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzamide (PubChem CID 137275788) has the molecular formula C53H20F15N5O and a molecular weight of 1027.75 g/mol. Its IUPAC name is 4-[2-[4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzamide.
| Compound Name | 4-[2-[4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 137275788 |
| Molecular Formula | C53H20F15N5O |
| Molecular Weight | 1027.75 g/mol |
| Exact Mass | 1027.14 |
| IUPAC Name | 4-[2-[4-[10,15,20-tris(2,3,4,5,6-pentafluorophenyl)-21,23-dihydroporphyrin-5-yl]phenyl]ethynyl]benzamide |
| SMILES | NC(=O)c1ccc(C#Cc2ccc(-c3c4nc(c(-c5c(F)c(F)c(F)c(F)c5F)c5ccc([nH]5)c(-c5c(F)c(F)c(F)c(F)c5F)c5nc(c(-c6c(F)c(F)c(F)c(F)c6F)c6ccc3[nH]6)C=C5)C=C4)cc2)cc1 |
| InChI | InChI=1S/C53H20F15N5O/c54-38-35(39(55)45(61)50(66)44(38)60)32-25-13-11-23(70-25)31(21-7-3-19(4-8-21)1-2-20-5-9-22(10-6-20)53(69)74)24-12-14-26(71-24)33(36-40(56)46(62)51(67)47(63)41(36)57)28-16-18-30(73-28)34(29-17-15-27(32)72-29)37-42(58)48(64)52(68)49(65)43(37)59/h3-18,70,73H,(H2,69,74)/b31-23-,31-24-,32-25+,32-27+,33-26+,33-28+,34-29+,34-30+ |
| InChIKey | AFUYKAYDRBSGOB-OICPIGJESA-N |
| XLogP | 13.91 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.75 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|