C36H21F6IN4O2 — CID 135427018
methyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)-21,23-dihydroporphyrin-5-yl]benzoate (PubChem CID 135427018) has the molecular formula C36H21F6IN4O2 and a molecular weight of 782.48 g/mol. Its IUPAC name is methyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)-21,23-dihydroporphyrin-5-yl]benzoate.
| Compound Name | methyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)-21,23-dihydroporphyrin-5-yl]benzoate |
|---|---|
| PubChem CID | 135427018 |
| Molecular Formula | C36H21F6IN4O2 |
| Molecular Weight | 782.48 g/mol |
| Exact Mass | 782.06 |
| IUPAC Name | methyl 4-[15-(4-iodophenyl)-10,20-bis(trifluoromethyl)-21,23-dihydroporphyrin-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(C(F)(F)F)c4ccc([nH]4)c(-c4ccc(I)cc4)c4nc(c(C(F)(F)F)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C36H21F6IN4O2/c1-49-34(48)20-4-2-18(3-5-20)30-22-10-14-26(44-22)32(35(37,38)39)28-16-12-24(46-28)31(19-6-8-21(43)9-7-19)25-13-17-29(47-25)33(36(40,41)42)27-15-11-23(30)45-27/h2-17,44,47H,1H3/b30-22-,30-23-,31-24-,31-25-,32-26+,32-28+,33-27+,33-29+ |
| InChIKey | DBNRMKCXWPDGHG-XOLXSKNWSA-N |
| XLogP | 10.42 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.48 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|