C33H21F9O6 — CID 177490253
methyl 4-[3,5-bis(4-methoxycarbonylphenyl)-2,4,6-tris(trifluoromethyl)phenyl]benzoate (PubChem CID 177490253) has the molecular formula C33H21F9O6 and a molecular weight of 684.51 g/mol. Its IUPAC name is methyl 4-[3,5-bis(4-methoxycarbonylphenyl)-2,4,6-tris(trifluoromethyl)phenyl]benzoate.
| Compound Name | methyl 4-[3,5-bis(4-methoxycarbonylphenyl)-2,4,6-tris(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 177490253 |
| Molecular Formula | C33H21F9O6 |
| Molecular Weight | 684.51 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | methyl 4-[3,5-bis(4-methoxycarbonylphenyl)-2,4,6-tris(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c(C(F)(F)F)c(-c3ccc(C(=O)OC)cc3)c(C(F)(F)F)c(-c3ccc(C(=O)OC)cc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C33H21F9O6/c1-46-28(43)19-10-4-16(5-11-19)22-25(31(34,35)36)23(17-6-12-20(13-7-17)29(44)47-2)27(33(40,41)42)24(26(22)32(37,38)39)18-8-14-21(15-9-18)30(45)48-3/h4-15H,1-3H3 |
| InChIKey | JSEMVXDSIKUOPR-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.51 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|