C24H20N2O8 — CID 122204693
dimethyl 2,5-bis(4-methoxycarbonylphenyl)pyrimidine-4,6-dicarboxylate (PubChem CID 122204693) has the molecular formula C24H20N2O8 and a molecular weight of 464.43 g/mol. Its IUPAC name is dimethyl 2,5-bis(4-methoxycarbonylphenyl)pyrimidine-4,6-dicarboxylate.
| Compound Name | dimethyl 2,5-bis(4-methoxycarbonylphenyl)pyrimidine-4,6-dicarboxylate |
|---|---|
| PubChem CID | 122204693 |
| Molecular Formula | C24H20N2O8 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | dimethyl 2,5-bis(4-methoxycarbonylphenyl)pyrimidine-4,6-dicarboxylate |
| SMILES | COC(=O)c1ccc(-c2nc(C(=O)OC)c(-c3ccc(C(=O)OC)cc3)c(C(=O)OC)n2)cc1 |
| InChI | InChI=1S/C24H20N2O8/c1-31-21(27)15-9-5-13(6-10-15)17-18(23(29)33-3)25-20(26-19(17)24(30)34-4)14-7-11-16(12-8-14)22(28)32-2/h5-12H,1-4H3 |
| InChIKey | XYMAESFVLGVVAW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|